C23H33IN4O2S — CID 110959708
N'-[3-(benzenesulfonyl)propyl]-4-benzyl-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110959708) has the molecular formula C23H33IN4O2S and a molecular weight of 556.51 g/mol. Its IUPAC name is N'-[3-(benzenesulfonyl)propyl]-4-benzyl-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(benzenesulfonyl)propyl]-4-benzyl-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110959708 |
| Molecular Formula | C23H33IN4O2S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | N'-[3-(benzenesulfonyl)propyl]-4-benzyl-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)c1ccccc1)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H32N4O2S.HI/c1-2-24-23(25-14-9-19-30(28,29)22-12-7-4-8-13-22)27-17-15-26(16-18-27)20-21-10-5-3-6-11-21;/h3-8,10-13H,2,9,14-20H2,1H3,(H,24,25);1H |
| InChIKey | PRRAIFRFYAYFHG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|