C21H28N4O2S — CID 110960093
N-[2-(benzenesulfonyl)ethyl]-4-benzyl-N'-methylpiperazine-1-carboximidamide (PubChem CID 110960093) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-4-benzyl-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-4-benzyl-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110960093 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-4-benzyl-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O2S/c1-22-21(23-12-17-28(26,27)20-10-6-3-7-11-20)25-15-13-24(14-16-25)18-19-8-4-2-5-9-19/h2-11H,12-18H2,1H3,(H,22,23) |
| InChIKey | CSQCBPALNJBIIJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|