C17H28IN3O2S — CID 111154439
N-[2-(benzenesulfonyl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111154439) has the molecular formula C17H28IN3O2S and a molecular weight of 465.40 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111154439 |
| Molecular Formula | C17H28IN3O2S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1)N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C17H27N3O2S.HI/c1-14-11-15(2)13-20(12-14)17(18-3)19-9-10-23(21,22)16-7-5-4-6-8-16;/h4-8,14-15H,9-13H2,1-3H3,(H,18,19);1H |
| InChIKey | WZVPLMUQIPLCGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|