C16H25N3O2S2 — CID 109486236
N-[2-(benzenesulfonyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109486236) has the molecular formula C16H25N3O2S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486236 |
| Molecular Formula | C16H25N3O2S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCS(=O)(=O)c2ccccc2)CCS1 |
| InChI | InChI=1S/C16H25N3O2S2/c1-3-14-13-19(10-11-22-14)16(17-2)18-9-12-23(20,21)15-7-5-4-6-8-15/h4-8,14H,3,9-13H2,1-2H3,(H,17,18) |
| InChIKey | NPYWJVYDNZYQBV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|