C15H26N4O2S3 — CID 109486104
2-ethyl-N'-methyl-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109486104) has the molecular formula C15H26N4O2S3 and a molecular weight of 390.60 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486104 |
| Molecular Formula | C15H26N4O2S3 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCNS(=O)(=O)c2ccc(C)s2)CCS1 |
| InChI | InChI=1S/C15H26N4O2S3/c1-4-13-11-19(9-10-22-13)15(16-3)17-7-8-18-24(20,21)14-6-5-12(2)23-14/h5-6,13,18H,4,7-11H2,1-3H3,(H,16,17) |
| InChIKey | ZFSLSIJPQVVODJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|