C14H31IN4O2S2 — CID 109486327
2-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486327) has the molecular formula C14H31IN4O2S2 and a molecular weight of 478.47 g/mol. Its IUPAC name is 2-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486327 |
| Molecular Formula | C14H31IN4O2S2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-ethyl-N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCCN(CC)S(C)(=O)=O)CCS1.I |
| InChI | InChI=1S/C14H30N4O2S2.HI/c1-5-13-12-17(10-11-21-13)14(15-3)16-8-7-9-18(6-2)22(4,19)20;/h13H,5-12H2,1-4H3,(H,15,16);1H |
| InChIKey | JGPDGQJZCRENOO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|