C15H33IN4S — CID 109485723
2-ethyl-N-[2-[ethyl(propyl)amino]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485723) has the molecular formula C15H33IN4S and a molecular weight of 428.43 g/mol. Its IUPAC name is 2-ethyl-N-[2-[ethyl(propyl)amino]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N-[2-[ethyl(propyl)amino]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485723 |
| Molecular Formula | C15H33IN4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-ethyl-N-[2-[ethyl(propyl)amino]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCCN(CC)CCN/C(=N\C)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C15H32N4S.HI/c1-5-9-18(7-3)10-8-17-15(16-4)19-11-12-20-14(6-2)13-19;/h14H,5-13H2,1-4H3,(H,16,17);1H |
| InChIKey | UJAPTOVEMMYUCN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|