C11H23FIN3S — CID 109487037
2-ethyl-N-(3-fluoropropyl)-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487037) has the molecular formula C11H23FIN3S and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-ethyl-N-(3-fluoropropyl)-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N-(3-fluoropropyl)-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109487037 |
| Molecular Formula | C11H23FIN3S |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-ethyl-N-(3-fluoropropyl)-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCCF)CCS1.I |
| InChI | InChI=1S/C11H22FN3S.HI/c1-3-10-9-15(7-8-16-10)11(13-2)14-6-4-5-12;/h10H,3-9H2,1-2H3,(H,13,14);1H |
| InChIKey | MSAJROLIHQRUKZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|