C16H32N4OS — CID 109484636
2-ethyl-N'-methyl-N-(4-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide (PubChem CID 109484636) has the molecular formula C16H32N4OS and a molecular weight of 328.53 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-(4-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-(4-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109484636 |
| Molecular Formula | C16H32N4OS |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 2-ethyl-N'-methyl-N-(4-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCCCN2CCOCC2)CCS1 |
| InChI | InChI=1S/C16H32N4OS/c1-3-15-14-20(10-13-22-15)16(17-2)18-6-4-5-7-19-8-11-21-12-9-19/h15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | VKVRBGVDDDRRIC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|