C16H32IN3OS — CID 109484677
N-(3-cyclopentyloxypropyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109484677) has the molecular formula C16H32IN3OS and a molecular weight of 441.42 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-(3-cyclopentyloxypropyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109484677 |
| Molecular Formula | C16H32IN3OS |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCCOC2CCCC2)CCS1.I |
| InChI | InChI=1S/C16H31N3OS.HI/c1-3-15-13-19(10-12-21-15)16(17-2)18-9-6-11-20-14-7-4-5-8-14;/h14-15H,3-13H2,1-2H3,(H,17,18);1H |
| InChIKey | ZXQLISNACOSYAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|