C16H26IN3OS — CID 109485883
2-ethyl-N'-methyl-N-(2-phenoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485883) has the molecular formula C16H26IN3OS and a molecular weight of 435.38 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-(2-phenoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-(2-phenoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485883 |
| Molecular Formula | C16H26IN3OS |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-ethyl-N'-methyl-N-(2-phenoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCOc2ccccc2)CCS1.I |
| InChI | InChI=1S/C16H25N3OS.HI/c1-3-15-13-19(10-12-21-15)16(17-2)18-9-11-20-14-7-5-4-6-8-14;/h4-8,15H,3,9-13H2,1-2H3,(H,17,18);1H |
| InChIKey | ZWUXKRLWFFQFRK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|