C19H27IN4S2 — CID 109485733
2-ethyl-N'-methyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485733) has the molecular formula C19H27IN4S2 and a molecular weight of 502.49 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485733 |
| Molecular Formula | C19H27IN4S2 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCc2csc(-c3ccccc3)n2)CCS1.I |
| InChI | InChI=1S/C19H26N4S2.HI/c1-3-17-13-23(11-12-24-17)19(20-2)21-10-9-16-14-25-18(22-16)15-7-5-4-6-8-15;/h4-8,14,17H,3,9-13H2,1-2H3,(H,20,21);1H |
| InChIKey | LEBKDNQSXGZGQK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|