C18H25ClIN5OS — CID 109485685
N-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485685) has the molecular formula C18H25ClIN5OS and a molecular weight of 521.86 g/mol. Its IUPAC name is N-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485685 |
| Molecular Formula | C18H25ClIN5OS |
| Molecular Weight | 521.86 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | N-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCc2nc(-c3cccc(Cl)c3)no2)CCS1.I |
| InChI | InChI=1S/C18H24ClN5OS.HI/c1-3-15-12-24(9-10-26-15)18(20-2)21-8-7-16-22-17(23-25-16)13-5-4-6-14(19)11-13;/h4-6,11,15H,3,7-10,12H2,1-2H3,(H,20,21);1H |
| InChIKey | LPMDZLBSBXKECY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|