C16H24F2IN3S — CID 109486079
N-[2-(2,5-difluorophenyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486079) has the molecular formula C16H24F2IN3S and a molecular weight of 455.36 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(2,5-difluorophenyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486079 |
| Molecular Formula | C16H24F2IN3S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCc2cc(F)ccc2F)CCS1.I |
| InChI | InChI=1S/C16H23F2N3S.HI/c1-3-14-11-21(8-9-22-14)16(19-2)20-7-6-12-10-13(17)4-5-15(12)18;/h4-5,10,14H,3,6-9,11H2,1-2H3,(H,19,20);1H |
| InChIKey | QVOCEDBLLZEVMA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|