C18H29N3OS — CID 109484890
2-ethyl-N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109484890) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is 2-ethyl-N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109484890 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-ethyl-N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCc2ccc(C)c(OC)c2)CCS1 |
| InChI | InChI=1S/C18H29N3OS/c1-5-16-13-21(10-11-23-16)18(19-3)20-9-8-15-7-6-14(2)17(12-15)22-4/h6-7,12,16H,5,8-11,13H2,1-4H3,(H,19,20) |
| InChIKey | PAGUZAONKOIWAN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|