C17H26BrN3O2S — CID 109485522
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109485522) has the molecular formula C17H26BrN3O2S and a molecular weight of 416.39 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485522 |
| Molecular Formula | C17H26BrN3O2S |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N\C)NCc2cc(Br)c(OC)c(OC)c2)CCS1 |
| InChI | InChI=1S/C17H26BrN3O2S/c1-5-13-11-21(6-7-24-13)17(19-2)20-10-12-8-14(18)16(23-4)15(9-12)22-3/h8-9,13H,5-7,10-11H2,1-4H3,(H,19,20) |
| InChIKey | XPLYNNBWOZNCMH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|