C17H27BrIN3O2 — CID 111209946
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111209946) has the molecular formula C17H27BrIN3O2 and a molecular weight of 512.23 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111209946 |
| Molecular Formula | C17H27BrIN3O2 |
| Molecular Weight | 512.23 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1cc(Br)c(OC)c(OC)c1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C17H26BrN3O2.HI/c1-12-5-7-21(8-6-12)17(19-2)20-11-13-9-14(18)16(23-4)15(10-13)22-3;/h9-10,12H,5-8,11H2,1-4H3,(H,19,20);1H |
| InChIKey | SYEBANZZFBTBMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|