C12H19BrIN3O2 — CID 110930422
1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110930422) has the molecular formula C12H19BrIN3O2 and a molecular weight of 444.11 g/mol. Its IUPAC name is 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110930422 |
| Molecular Formula | C12H19BrIN3O2 |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1cc(Br)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C12H18BrN3O2.HI/c1-14-12(15-2)16-7-8-5-9(13)11(18-4)10(6-8)17-3;/h5-6H,7H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | JFQOWHGVTGWMFO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|