C19H25BrIN3O2 — CID 110949219
1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 110949219) has the molecular formula C19H25BrIN3O2 and a molecular weight of 534.24 g/mol. Its IUPAC name is 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110949219 |
| Molecular Formula | C19H25BrIN3O2 |
| Molecular Weight | 534.24 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(Br)c(OC)c(OC)c1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C19H24BrN3O2.HI/c1-13(15-8-6-5-7-9-15)23-19(21-2)22-12-14-10-16(20)18(25-4)17(11-14)24-3;/h5-11,13H,12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | VRNSMCQEQZHMQL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|