C19H26BrN3O2S — CID 111674448
1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 111674448) has the molecular formula C19H26BrN3O2S and a molecular weight of 440.41 g/mol. Its IUPAC name is 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111674448 |
| Molecular Formula | C19H26BrN3O2S |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | C/N=C(/NCc1cc(Br)c(OC)c(OC)c1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C19H26BrN3O2S/c1-13(8-15-6-5-7-26-15)11-22-19(21-2)23-12-14-9-16(20)18(25-4)17(10-14)24-3/h5-7,9-10,13H,8,11-12H2,1-4H3,(H2,21,22,23) |
| InChIKey | XEUADEXLBHWGBV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|