C20H26F3N3O2S — CID 111673594
1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 111673594) has the molecular formula C20H26F3N3O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111673594 |
| Molecular Formula | C20H26F3N3O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)c(OC)c1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C20H26F3N3O2S/c1-14(9-16-5-4-8-29-16)11-25-19(24-2)26-12-15-6-7-17(18(10-15)27-3)28-13-20(21,22)23/h4-8,10,14H,9,11-13H2,1-3H3,(H2,24,25,26) |
| InChIKey | FEFWECHZCZEHQZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|