C19H29F3N4O4 — CID 111885339
tert-butyl N-[2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885339) has the molecular formula C19H29F3N4O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885339 |
| Molecular Formula | C19H29F3N4O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | tert-butyl N-[2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1ccc(OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C19H29F3N4O4/c1-18(2,3)30-17(27)25-9-8-24-16(23-4)26-11-13-6-7-14(15(10-13)28-5)29-12-19(20,21)22/h6-7,10H,8-9,11-12H2,1-5H3,(H,25,27)(H2,23,24,26) |
| InChIKey | PXQJWCQFVROQRD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|