C20H35IN4O4 — CID 111773271
tert-butyl N-[1-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide (PubChem CID 111773271) has the molecular formula C20H35IN4O4 and a molecular weight of 522.43 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111773271 |
| Molecular Formula | C20H35IN4O4 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | tert-butyl N-[1-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC)c1)NCC(C)(C)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C20H34N4O4.HI/c1-19(2,3)28-18(25)24-20(4,5)13-23-17(21-6)22-12-14-9-10-15(26-7)16(11-14)27-8;/h9-11H,12-13H2,1-8H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | PZSQURMGICPGLS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|