C18H28F3N3O4 — CID 111404495
1-[3-(2-methoxyethoxy)propyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111404495) has the molecular formula C18H28F3N3O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111404495 |
| Molecular Formula | C18H28F3N3O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCCOC)NCc1ccc(OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H28F3N3O4/c1-22-17(23-7-4-8-27-10-9-25-2)24-12-14-5-6-15(16(11-14)26-3)28-13-18(19,20)21/h5-6,11H,4,7-10,12-13H2,1-3H3,(H2,22,23,24) |
| InChIKey | IEOXQUKPQUROFG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|