C19H21F5IN3O2 — CID 111903258
1-[(2,5-difluorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111903258) has the molecular formula C19H21F5IN3O2 and a molecular weight of 545.29 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111903258 |
| Molecular Formula | C19H21F5IN3O2 |
| Molecular Weight | 545.29 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)c(OC)c1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C19H20F5N3O2.HI/c1-25-18(27-10-13-8-14(20)4-5-15(13)21)26-9-12-3-6-16(17(7-12)28-2)29-11-19(22,23)24;/h3-8H,9-11H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | VNQUCVSUXGAUCD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|