C20H23F4N3O2 — CID 111889995
1-[(4-ethoxy-3-methoxyphenyl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111889995) has the molecular formula C20H23F4N3O2 and a molecular weight of 413.42 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxyphenyl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(4-ethoxy-3-methoxyphenyl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111889995 |
| Molecular Formula | C20H23F4N3O2 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxyphenyl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | CCOc1ccc(CN/C(=N\C)NCc2ccc(F)cc2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C20H23F4N3O2/c1-4-29-17-8-5-13(9-18(17)28-3)11-26-19(25-2)27-12-14-6-7-15(21)10-16(14)20(22,23)24/h5-10H,4,11-12H2,1-3H3,(H2,25,26,27) |
| InChIKey | JSQISSLWOBKATL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|