C17H18F4N4 — CID 119149529
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine (PubChem CID 119149529) has the molecular formula C17H18F4N4 and a molecular weight of 354.35 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 119149529 |
| Molecular Formula | C17H18F4N4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(C)nc1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H18F4N4/c1-11-3-4-12(8-23-11)9-24-16(22-2)25-10-13-5-6-14(18)7-15(13)17(19,20)21/h3-8H,9-10H2,1-2H3,(H2,22,24,25) |
| InChIKey | JFDKHQKDZYSSJS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|