C19H23F4IN4O — CID 111889566
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111889566) has the molecular formula C19H23F4IN4O and a molecular weight of 526.32 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111889566 |
| Molecular Formula | C19H23F4IN4O |
| Molecular Weight | 526.32 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(F)cc1C(F)(F)F)NCc1ncc(C)c(OC)c1C.I |
| InChI | InChI=1S/C19H22F4N4O.HI/c1-11-8-25-16(12(2)17(11)28-4)10-27-18(24-3)26-9-13-5-6-14(20)7-15(13)19(21,22)23;/h5-8H,9-10H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | PRAGMZWGTJJADV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|