C20H25F3N4O — CID 111295849
1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111295849) has the molecular formula C20H25F3N4O and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111295849 |
| Molecular Formula | C20H25F3N4O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(C(F)(F)F)cc1)NCc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C20H25F3N4O/c1-13-11-26-17(14(2)18(13)28-4)12-27-19(24-3)25-10-9-15-5-7-16(8-6-15)20(21,22)23/h5-8,11H,9-10,12H2,1-4H3,(H2,24,25,27) |
| InChIKey | GUHIMSGHDIAGDQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|