C18H22F4N4S — CID 111890219
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111890219) has the molecular formula C18H22F4N4S and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111890219 |
| Molecular Formula | C18H22F4N4S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1csc(C(C)(C)C)n1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H22F4N4S/c1-17(2,3)15-26-13(10-27-15)9-25-16(23-4)24-8-11-5-6-12(19)7-14(11)18(20,21)22/h5-7,10H,8-9H2,1-4H3,(H2,23,24,25) |
| InChIKey | NBQWEEHEERCCBI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|