C16H21F4N3O — CID 119155661
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine (PubChem CID 119155661) has the molecular formula C16H21F4N3O and a molecular weight of 347.36 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 119155661 |
| Molecular Formula | C16H21F4N3O |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(2-hydroxycyclopentyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(F)cc1C(F)(F)F)NCC1CCCC1O |
| InChI | InChI=1S/C16H21F4N3O/c1-21-15(23-9-11-3-2-4-14(11)24)22-8-10-5-6-12(17)7-13(10)16(18,19)20/h5-7,11,14,24H,2-4,8-9H2,1H3,(H2,21,22,23) |
| InChIKey | QWDIQECOYHTENF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|