C17H23F4IN4O — CID 111889822
N-cyclopropyl-4-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 111889822) has the molecular formula C17H23F4IN4O and a molecular weight of 502.29 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111889822 |
| Molecular Formula | C17H23F4IN4O |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | N-cyclopropyl-4-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C17H22F4N4O.HI/c1-22-16(23-8-2-3-15(26)25-13-6-7-13)24-10-11-4-5-12(18)9-14(11)17(19,20)21;/h4-5,9,13H,2-3,6-8,10H2,1H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | XVXHUMOKSOLZAD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|