C19H30F4N4 — CID 111889979
1-[7-(dimethylamino)heptyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111889979) has the molecular formula C19H30F4N4 and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[7-(dimethylamino)heptyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[7-(dimethylamino)heptyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111889979 |
| Molecular Formula | C19H30F4N4 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-[7-(dimethylamino)heptyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCCCCCN(C)C)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H30F4N4/c1-24-18(25-11-7-5-4-6-8-12-27(2)3)26-14-15-9-10-16(20)13-17(15)19(21,22)23/h9-10,13H,4-8,11-12,14H2,1-3H3,(H2,24,25,26) |
| InChIKey | HWOCLSPOBFFSGT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|