C19H23F4N5 — CID 111889931
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111889931) has the molecular formula C19H23F4N5 and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111889931 |
| Molecular Formula | C19H23F4N5 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | C/N=C(\NCCCCNc1ccccn1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H23F4N5/c1-24-18(27-11-5-4-10-26-17-6-2-3-9-25-17)28-13-14-7-8-15(20)12-16(14)19(21,22)23/h2-3,6-9,12H,4-5,10-11,13H2,1H3,(H,25,26)(H2,24,27,28) |
| InChIKey | LILVGPZKTVLXRM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|