C17H26F4N4 — CID 111889247
1-[3-(diethylamino)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111889247) has the molecular formula C17H26F4N4 and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111889247 |
| Molecular Formula | C17H26F4N4 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | CCN(CC)CCCN/C(=N\C)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H26F4N4/c1-4-25(5-2)10-6-9-23-16(22-3)24-12-13-7-8-14(18)11-15(13)17(19,20)21/h7-8,11H,4-6,9-10,12H2,1-3H3,(H2,22,23,24) |
| InChIKey | NVUGWYIZPYJKKX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|