C18H21F4IN4OS — CID 111889546
N-[3-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111889546) has the molecular formula C18H21F4IN4OS and a molecular weight of 544.36 g/mol. Its IUPAC name is N-[3-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111889546 |
| Molecular Formula | C18H21F4IN4OS |
| Molecular Weight | 544.36 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | N-[3-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1cccs1)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C18H20F4N4OS.HI/c1-23-17(25-8-3-7-24-16(27)15-4-2-9-28-15)26-11-12-5-6-13(19)10-14(12)18(20,21)22;/h2,4-6,9-10H,3,7-8,11H2,1H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | MLJAEYDMASGQEX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|