C13H20F3IN4OS — CID 109473956
N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 109473956) has the molecular formula C13H20F3IN4OS and a molecular weight of 464.30 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109473956 |
| Molecular Formula | C13H20F3IN4OS |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCNC(=O)c1cccs1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C13H19F3N4OS.HI/c1-17-12(20-8-5-13(14,15)16)19-7-3-6-18-11(21)10-4-2-9-22-10;/h2,4,9H,3,5-8H2,1H3,(H,18,21)(H2,17,19,20);1H |
| InChIKey | RIGDZHMEXSVZGK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|