C16H28N4OS — CID 111161643
N-[3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propyl]thiophene-2-carboxamide (PubChem CID 111161643) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is N-[3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111161643 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propyl]thiophene-2-carboxamide |
| SMILES | CCCCCCN/C(=N\C)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H28N4OS/c1-3-4-5-6-10-19-16(17-2)20-12-8-11-18-15(21)14-9-7-13-22-14/h7,9,13H,3-6,8,10-12H2,1-2H3,(H,18,21)(H2,17,19,20) |
| InChIKey | NNDUDLZENKXWDX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|