C16H23N5OS2 — CID 111535702
N-[3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 111535702) has the molecular formula C16H23N5OS2 and a molecular weight of 365.53 g/mol. Its IUPAC name is N-[3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111535702 |
| Molecular Formula | C16H23N5OS2 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCc1cnc(CN/C(=N/C)NCCCNC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C16H23N5OS2/c1-3-12-10-20-14(24-12)11-21-16(17-2)19-8-5-7-18-15(22)13-6-4-9-23-13/h4,6,9-10H,3,5,7-8,11H2,1-2H3,(H,18,22)(H2,17,19,21) |
| InChIKey | JYQSXRGBRWFRGK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|