C12H23N5O2S2 — CID 111534562
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine (PubChem CID 111534562) has the molecular formula C12H23N5O2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111534562 |
| Molecular Formula | C12H23N5O2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N/C)NCCCNS(C)(=O)=O)s1 |
| InChI | InChI=1S/C12H23N5O2S2/c1-4-10-8-15-11(20-10)9-16-12(13-2)14-6-5-7-17-21(3,18)19/h8,17H,4-7,9H2,1-3H3,(H2,13,14,16) |
| InChIKey | ANJKWWUBKZGMFU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|