C17H24ClIN4S — CID 111535974
1-[3-(4-chlorophenyl)propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111535974) has the molecular formula C17H24ClIN4S and a molecular weight of 478.83 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(4-chlorophenyl)propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111535974 |
| Molecular Formula | C17H24ClIN4S |
| Molecular Weight | 478.83 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 1-[3-(4-chlorophenyl)propyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCCCc2ccc(Cl)cc2)s1.I |
| InChI | InChI=1S/C17H23ClN4S.HI/c1-3-15-11-21-16(23-15)12-22-17(19-2)20-10-4-5-13-6-8-14(18)9-7-13;/h6-9,11H,3-5,10,12H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | LHTNQYJRVABACO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|