C18H24ClN5OS — CID 111534700
N-(4-chlorophenyl)-4-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanamide (PubChem CID 111534700) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111534700 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanamide |
| SMILES | CCc1cnc(CN/C(=N\C)NCCCC(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H24ClN5OS/c1-3-15-11-22-17(26-15)12-23-18(20-2)21-10-4-5-16(25)24-14-8-6-13(19)7-9-14/h6-9,11H,3-5,10,12H2,1-2H3,(H,24,25)(H2,20,21,23) |
| InChIKey | MAHQSLUMIBJKQY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|