C15H27N5OS — CID 111534604
N-butan-2-yl-3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111534604) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111534604 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-butan-2-yl-3-[[N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | CCc1cnc(CN/C(=N/C)NCCC(=O)NC(C)CC)s1 |
| InChI | InChI=1S/C15H27N5OS/c1-5-11(3)20-13(21)7-8-17-15(16-4)19-10-14-18-9-12(6-2)22-14/h9,11H,5-8,10H2,1-4H3,(H,20,21)(H2,16,17,19) |
| InChIKey | KTEKOXVTQZGBGP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|