C13H25N7O — CID 111706383
N-butan-2-yl-3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111706383) has the molecular formula C13H25N7O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111706383 |
| Molecular Formula | C13H25N7O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-butan-2-yl-3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)NCc1ncnn1C |
| InChI | InChI=1S/C13H25N7O/c1-5-10(2)19-12(21)6-7-15-13(14-3)16-8-11-17-9-18-20(11)4/h9-10H,5-8H2,1-4H3,(H,19,21)(H2,14,15,16) |
| InChIKey | UPHSRRKQMYDXCJ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|