C15H30N6 — CID 111708115
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-nonylguanidine (PubChem CID 111708115) has the molecular formula C15H30N6 and a molecular weight of 294.45 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-nonylguanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-nonylguanidine |
|---|---|
| PubChem CID | 111708115 |
| Molecular Formula | C15H30N6 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-nonylguanidine |
| SMILES | CCCCCCCCCN/C(=N\C)NCc1ncnn1C |
| InChI | InChI=1S/C15H30N6/c1-4-5-6-7-8-9-10-11-17-15(16-2)18-12-14-19-13-20-21(14)3/h13H,4-12H2,1-3H3,(H2,16,17,18) |
| InChIKey | OTOXJOCBOHUSHJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|