C12H23N5 — CID 111129525
2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-pentylguanidine (PubChem CID 111129525) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-pentylguanidine.
| Compound Name | 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-pentylguanidine |
|---|---|
| PubChem CID | 111129525 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-pentylguanidine |
| SMILES | CCCCCN/C(=N\C)NCc1ccnn1C |
| InChI | InChI=1S/C12H23N5/c1-4-5-6-8-14-12(13-2)15-10-11-7-9-16-17(11)3/h7,9H,4-6,8,10H2,1-3H3,(H2,13,14,15) |
| InChIKey | MXKIWHGBRNGFEU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|