C12H24N6O2S — CID 111954261
1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111954261) has the molecular formula C12H24N6O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111954261 |
| Molecular Formula | C12H24N6O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCS(=O)(=O)NCCCN/C(=N\C)NCc1ccnn1C |
| InChI | InChI=1S/C12H24N6O2S/c1-4-21(19,20)17-8-5-7-14-12(13-2)15-10-11-6-9-16-18(11)3/h6,9,17H,4-5,7-8,10H2,1-3H3,(H2,13,14,15) |
| InChIKey | IABCGXCCDLFSGX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|