C15H23IN6O2S — CID 111955706
1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111955706) has the molecular formula C15H23IN6O2S and a molecular weight of 478.36 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111955706 |
| Molecular Formula | C15H23IN6O2S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1ccccc1)NCc1ccnn1C.I |
| InChI | InChI=1S/C15H22N6O2S.HI/c1-16-15(18-12-13-8-9-19-21(13)2)17-10-11-20-24(22,23)14-6-4-3-5-7-14;/h3-9,20H,10-12H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | QMVMFKUZNQTPLT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|