C15H22IN5O2S2 — CID 111522203
1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111522203) has the molecular formula C15H22IN5O2S2 and a molecular weight of 495.41 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522203 |
| Molecular Formula | C15H22IN5O2S2 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1ccccc1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C15H21N5O2S2.HI/c1-12-10-18-14(23-12)11-19-15(16-2)17-8-9-20-24(21,22)13-6-4-3-5-7-13;/h3-7,10,20H,8-9,11H2,1-2H3,(H2,16,17,19);1H |
| InChIKey | BLSPTUPIVGNBKO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|