C15H19FN4S — CID 111517081
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111517081) has the molecular formula C15H19FN4S and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111517081 |
| Molecular Formula | C15H19FN4S |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1ccccc1F)NCc1ncc(C)s1 |
| InChI | InChI=1S/C15H19FN4S/c1-11-9-19-14(21-11)10-20-15(17-2)18-8-7-12-5-3-4-6-13(12)16/h3-6,9H,7-8,10H2,1-2H3,(H2,17,18,20) |
| InChIKey | LJFSKYSPYRUODT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|